Difference between revisions of "RXN-16151"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * inchi key: ** InChIKey=PO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] == * direction: ** REVERSIBLE * common name: ** Lyso-phosphatidylcholine acylt...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] ==
−
* smiles:
+
* direction:
−
** C1(NC(N)=O)(NC(=O)NC(=O)1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=POJWUDADGALRAB-SFOWXEAESA-N
+
 
* common name:
 
* common name:
−
** (S)-(+)-allantoin
+
** Lyso-phosphatidylcholine acyltransferase
−
* molecular weight:
+
* ec number:
−
** 158.116   
+
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** S-allantoin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ALLANTOINASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15364]][c] '''+''' 1 [[Glycerolipids]][c] '''<=>''' 1 [[CPD-17396]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN-6201]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 ricinoleoyl-CoA[c] '''+''' 1 a glycerolipid[c] '''<=>''' 1 a [glycerolipid]-ricinoleate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_002160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 +
** '''7''' reactions found over '''22''' reactions in the full pathway
 +
* [[PWY-7618]], ricinoleate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 37849
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=Lyso-phosphatidylcholine acyltransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439714 439714]
+
{{#set: ec number=EC-2.3.1.23}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-16_002160}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02350 C02350]
+
{{#set: in pathway=PWY-6433|PWY-7618}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.388780.html 388780]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15678 15678]
+
−
* METABOLIGHTS : MTBLC15678
+
−
{{#set: smiles=C1(NC(N)=O)(NC(=O)NC(=O)1)}}
+
−
{{#set: inchi key=InChIKey=POJWUDADGALRAB-SFOWXEAESA-N}}
+
−
{{#set: common name=(S)-(+)-allantoin}}
+
−
{{#set: molecular weight=158.116    }}
+
−
{{#set: common name=S-allantoin}}
+
−
{{#set: consumed by=ALLANTOINASE-RXN}}
+
−
{{#set: produced by=RXN-6201}}
+

Latest revision as of 19:27, 21 March 2018

Reaction RXN-16151

  • direction:
    • REVERSIBLE
  • common name:
    • Lyso-phosphatidylcholine acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ricinoleoyl-CoA[c] + 1 a glycerolipid[c] <=> 1 a [glycerolipid]-ricinoleate[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6433, hydroxylated fatty acid biosynthesis (plants): PWY-6433
    • 7 reactions found over 22 reactions in the full pathway
  • PWY-7618, ricinoleate biosynthesis: PWY-7618
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16151&oldid=26959"