Difference between revisions of "ARGININE-SYN4-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGININE-SYN4-PWY ARGININE-SYN4-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGININE-SYN4-PWY ARGININE-SYN4-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
+
 
* common name:
 
* common name:
** ergosta-5,7-dienol
+
** L-ornithine biosynthesis II
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
* [[RXN-13883]]
+
* [[GLUTKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-27_003730]]
 +
*** [[Ec-24_000610]]
 +
*** [[Ec-07_007490]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-07_007490]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_003730]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-DEHYDROGENASE-NADP+-RXN GLUTAMATE-DEHYDROGENASE-NADP+-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659257 90659257]
+
{{#set: common name=L-ornithine biosynthesis II}}
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction found=3}}
{{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}}
+
{{#set: total reaction=4}}
{{#set: common name=ergosta-5,7-dienol}}
+
{{#set: completion rate=75.0}}
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN-13883}}
+

Latest revision as of 19:27, 21 March 2018

Pathway ARGININE-SYN4-PWY

  • taxonomic range:
  • common name:
    • L-ornithine biosynthesis II
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links