Difference between revisions of "Ec-28 001790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Ec-28_001790 == * left end position: ** 1557973 * transcription direction: ** NEGATIVE * right end position: ** 1567533 * centisome position: ** 41.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Gene Ec-28_001790 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1557973
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
+
** 1567533
−
* molecular weight:
+
* centisome position:
−
** 959.791    
+
** 41.1181    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-12:1-Δ5-CoA
+
** Esi_0033_0021
−
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
+
** Esi0033_0021
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17798]]
+
* Reaction: [[GPH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17797]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-181]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=1557973}}
−
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
+
{{#set: right end position=1567533}}
−
{{#set: molecular weight=959.791   }}
+
{{#set: centisome position=41.1181   }}
−
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
+
{{#set: common name=Esi_0033_0021|Esi0033_0021}}
−
{{#set: consumed by=RXN-17798}}
+
{{#set: reaction associated=GPH-RXN}}
−
{{#set: produced by=RXN-17797}}
+
{{#set: pathway associated=PWY-181}}

Latest revision as of 19:27, 21 March 2018

Gene Ec-28_001790

  • left end position:
    • 1557973
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1567533
  • centisome position:
    • 41.1181
  • Synonym(s):
    • Esi_0033_0021
    • Esi0033_0021

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_001790&oldid=26990"