Difference between revisions of "PWY-6527"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * inchi key: ** InChIKey=PO...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** stachyose degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''5''' reactions found over '''7''' reactions in the full pathway |
| − | + | * [[GALACTOKIN-RXN]] | |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-04_000280]] |
| + | *** [[Ec-04_004180]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[GALACTURIDYLYLTRANS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-00_010010]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[GLUC1PURIDYLTRANS-RXN]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Ec-03_002030]] | ||
| + | *** [[Ec-12_002300]] | ||
| + | *** [[Ec-16_004100]] | ||
| + | *** [[Ec-05_002180]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN-11501]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-17_000840]] | ||
| + | *** [[Ec-26_006290]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[UDPGLUCEPIM-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Ec-04_000280]] | ||
| + | *** [[Ec-04_004180]] | ||
| + | *** [[Ec-05_006710]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11502 RXN-11502] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=UTPHEXPURIDYLYLTRANS-RXN UTPHEXPURIDYLYLTRANS-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=stachyose degradation}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=71.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:27, 21 March 2018
Pathway PWY-6527
- taxonomic range:
- common name:
- stachyose degradation
- Synonym(s):
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- GALACTOKIN-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- GALACTURIDYLYLTRANS-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GLUC1PURIDYLTRANS-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-11501
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- UDPGLUCEPIM-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
