Difference between revisions of "General-Protein-Substrates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] == * common name: ** a protein * Synonym...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
* inchi key:
+
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
+
 
* common name:
 
* common name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
+
** a protein
* molecular weight:
+
** 1039.92   
+
 
* Synonym(s):
 
* Synonym(s):
** oxopentenyl-cyclopentane-octanoyl-CoA
 
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
 
** OPC-8:0-CoA
 
** OPC8-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10696]]
+
* [[3.4.25.1-RXN]]
 +
* [[3.4.23.34-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.22.16-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.21.26-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.21.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-1061]]
 +
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[DISULISOM-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a protein}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
+
{{#set: consumed by=3.4.25.1-RXN|3.4.23.34-RXN|3.4.21.92-RXN|3.4.22.16-RXN|3.4.21.102-RXN|3.4.23.1-RXN|3.4.22.1-RXN|3.4.21.26-RXN|3.4.22.15-RXN|3.4.21.53-RXN|3.4.21.4-RXN}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: reversible reaction associated=RXN0-1061|ARGINYLTRANSFERASE-RXN|DISULISOM-RXN}}
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
+
{{#set: molecular weight=1039.92   }}
+
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
+
{{#set: consumed by=RXN-10696}}
+

Latest revision as of 19:27, 21 March 2018

Metabolite General-Protein-Substrates

  • common name:
    • a protein
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links