Difference between revisions of "General-Protein-Substrates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] == * common name: ** a protein * Synonym...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] ==
−
* smiles:
+
−
** CC(CC([N+])C([O-])=O)C
+
−
* inchi key:
+
−
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
+
 
* common name:
 
* common name:
−
** L-leucine
+
** a protein
−
* molecular weight:
+
−
** 131.174   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2S)-α-2-amino-4-methylvaleric acid
 
−
** L
 
−
** leu
 
−
** leucine
 
−
** 2-amino-4-methylvaleric acid
 
−
** (2S)-α-leucine
 
−
** L-leu
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
* [[3.4.25.1-RXN]]
−
* [[biomass_rxn]]
+
* [[3.4.23.34-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.22.16-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.21.26-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.21.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* [[RXN0-1061]]
 +
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[DISULISOM-RXN]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: common name=a protein}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709]
+
{{#set: consumed by=3.4.25.1-RXN|3.4.23.34-RXN|3.4.21.92-RXN|3.4.22.16-RXN|3.4.21.102-RXN|3.4.23.1-RXN|3.4.22.1-RXN|3.4.21.26-RXN|3.4.22.15-RXN|3.4.21.53-RXN|3.4.21.4-RXN}}
−
* CAS : 61-90-5
+
{{#set: reversible reaction associated=RXN0-1061|ARGINYLTRANSFERASE-RXN|DISULISOM-RXN}}
−
* BIGG : 33942
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798]
+
−
* HMDB : HMDB00687
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427]
+
−
* METABOLIGHTS : MTBLC57427
+
−
{{#set: smiles=CC(CC([N+])C([O-])=O)C}}
+
−
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}}
+
−
{{#set: common name=L-leucine}}
+
−
{{#set: molecular weight=131.174    }}
+
−
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}}
+
−
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}}
+
−
{{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}}
+

Latest revision as of 19:27, 21 March 2018

Metabolite General-Protein-Substrates

  • common name:
    • a protein
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=General-Protein-Substrates&oldid=27014"