Difference between revisions of "PWY-7137"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** quercetin gentiotetraside biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
− | * [[ | + | * [[RXN1F-462]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Ec-14_000870]] |
− | == Reaction(s) | + | *** [[Ec-04_004610]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | = | + | *** [[orthology-aragem]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13797 RXN-13797] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13798 RXN-13798] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13799 RXN-13799] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3398}} | |
− | + | {{#set: common name=quercetin gentiotetraside biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:27, 21 March 2018
Pathway PWY-7137
- taxonomic range:
- common name:
- quercetin gentiotetraside biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN1F-462
- 2 associated gene(s):
- 1 reconstruction source(s) associated: