Difference between revisions of "CPD-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14391 RXN-14391] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14391 RXN-14391] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.6.4 EC-3.6.4]
+
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
 +
* common name:
 +
** (+)-taxifolin
 +
* molecular weight:
 +
** 303.248   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans dihydroquercetin
 +
** (+)-dihydroquercetin
 +
** taxifolin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-527]]
−
** 1 [[Chap-ADP-apo-SP-Complex]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[D-form-FeS-Cluster-Scaffold-Proteins]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[FeS-Cluster-Chaperones-ATP]][c]
+
* [[RXN-600]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 a [chaperone-ADP]-[disordered-form scaffold protein] complex[c] '''+''' 1 ATP[c] '''=>''' 1 a [disordered-form [Fe-S] cluster scaffold protein][c] '''+''' 1 ADP[c] '''+''' 1 an [Fe-S cluster biosynthesis chaperone]-ATP[c]
+
* [[RXN-7775]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
+
−
** '''10''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 480-18-2
−
{{#set: ec number=EC-3.6.4}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-7250}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
 +
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
 +
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
 +
{{#set: common name=(+)-taxifolin}}
 +
{{#set: molecular weight=303.248    }}
 +
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
 +
{{#set: consumed by=RXN-527|RXN-600}}
 +
{{#set: produced by=RXN-7775}}

Latest revision as of 19:27, 21 March 2018

Metabolite CPD-474

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
  • inchi key:
    • InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
  • common name:
    • (+)-taxifolin
  • molecular weight:
    • 303.248
  • Synonym(s):
    • trans dihydroquercetin
    • (+)-dihydroquercetin
    • taxifolin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-474&oldid=27024"