Difference between revisions of "CPD-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] == * direction: ** REVERSIBLE * common name: ** Lyso-phosphatidylcholine acylt...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
 +
* inchi key:
 +
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
 
* common name:
 
* common name:
−
** Lyso-phosphatidylcholine acyltransferase
+
** (+)-taxifolin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
+
** 303.248   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans dihydroquercetin
 +
** (+)-dihydroquercetin
 +
** taxifolin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-527]]
−
** 1 [[CPD-15364]][c] '''+''' 1 [[Glycerolipids]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17396]][c]
+
* [[RXN-600]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 ricinoleoyl-CoA[c] '''+''' 1 a glycerolipid[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 a [glycerolipid]-ricinoleate[c]
+
* [[RXN-7775]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-16_002160]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7618]], ricinoleate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7618 PWY-7618]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
+
−
** '''7''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* CAS : 480-18-2
−
{{#set: common name=Lyso-phosphatidylcholine acyltransferase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.23}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
−
{{#set: gene associated=Ec-16_002160}}
+
* CHEBI:
−
{{#set: in pathway=PWY-7618|PWY-6433}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
 +
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
 +
{{#set: common name=(+)-taxifolin}}
 +
{{#set: molecular weight=303.248    }}
 +
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
 +
{{#set: consumed by=RXN-527|RXN-600}}
 +
{{#set: produced by=RXN-7775}}

Latest revision as of 19:27, 21 March 2018

Metabolite CPD-474

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
  • inchi key:
    • InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
  • common name:
    • (+)-taxifolin
  • molecular weight:
    • 303.248
  • Synonym(s):
    • trans dihydroquercetin
    • (+)-dihydroquercetin
    • taxifolin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-474&oldid=27024"