Difference between revisions of "CPD-11517"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) |
+ | * inchi key: | ||
+ | ** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA |
+ | * molecular weight: | ||
+ | ** 1039.92 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oxopentenyl-cyclopentane-octanoyl-CoA | ||
+ | ** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA | ||
+ | ** OPC-8:0-CoA | ||
+ | ** OPC8-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10696]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325] |
− | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}} |
− | {{#set: | + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}} |
+ | {{#set: molecular weight=1039.92 }} | ||
+ | {{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}} | ||
+ | {{#set: consumed by=RXN-10696}} |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite CPD-11517
- smiles:
- CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- inchi key:
- InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
- molecular weight:
- 1039.92
- Synonym(s):
- oxopentenyl-cyclopentane-octanoyl-CoA
- 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
- OPC-8:0-CoA
- OPC8-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.
"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA" cannot be used as a page name in this wiki.