Difference between revisions of "CPD-11674"

Latest revision as of 19:27, 21 March 2018

"C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-246-N-linked-Glycan 24-246-N-linked-Glycan] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+* smiles:
+** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
+* inchi key:
+** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
 * common name:
-** a [(2,4),(2,4,6)]-N-linked glycan
+** 5-hydroxytryptophol sulfate
+* molecular weight:
+** 256.253
 * Synonym(s):
+** 5-hydroxytryptophol sulphate
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[2.4.1.201-RXN]]
+* [[RXN-10782]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a [(2,4),(2,4,6)]-N-linked glycan}}
+* PUBCHEM:
-{{#set: produced by=2.4.1.201-RXN}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265]
+{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}}
+{{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}}
+{{#set: common name=5-hydroxytryptophol sulfate}}
+{{#set: molecular weight=256.253    }}
+{{#set: common name=5-hydroxytryptophol sulphate}}
+{{#set: produced by=RXN-10782}}