Difference between revisions of "1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN 1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN] == * direction: ** LEFT-TO...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN 1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1-phosphatidylinositol-3-kinase |
− | * | + | ** putative phosphatidylinositol 3-kinase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.7.1.137 EC-2.7.1.137] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[L-1-phosphatidyl-inositols]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-177]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 an L-1-phosphatidyl-inositol[c] '''=>''' 1 H+[c] '''+''' 1 a 1-phosphatidyl-1D-myo-inositol 3-phosphate[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_006380]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-04_003810]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6352]], 3-phosphoinositide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6352 PWY-6352] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12709 12709] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03362 R03362] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P22543 P22543] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q13315 Q13315] |
− | * | + | ** [http://www.uniprot.org/uniprot/P32871 P32871] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P42338 P42338] |
− | * | + | ** [http://www.uniprot.org/uniprot/P42336 P42336] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32600 P32600] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P35169 P35169] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O04269 O04269] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P91634 P91634] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q92213 Q92213] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P54673 P54673] |
+ | ** [http://www.uniprot.org/uniprot/P54674 P54674] | ||
+ | ** [http://www.uniprot.org/uniprot/P54675 P54675] | ||
+ | ** [http://www.uniprot.org/uniprot/P54677 P54677] | ||
+ | ** [http://www.uniprot.org/uniprot/O35904 O35904] | ||
+ | ** [http://www.uniprot.org/uniprot/P50520 P50520] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=1-phosphatidylinositol-3-kinase}} | ||
+ | {{#set: common name=putative phosphatidylinositol 3-kinase}} | ||
+ | {{#set: ec number=EC-2.7.1.137}} | ||
+ | {{#set: gene associated=Ec-12_006380|Ec-04_003810}} | ||
+ | {{#set: in pathway=PWY-6352}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:27, 21 March 2018
Contents
Reaction 1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 1-phosphatidylinositol-3-kinase
- putative phosphatidylinositol 3-kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 L-1-phosphatidyl-inositols[c] => 1 PROTON[c] + 1 CPD-177[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 an L-1-phosphatidyl-inositol[c] => 1 H+[c] + 1 a 1-phosphatidyl-1D-myo-inositol 3-phosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_006380
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-04_003810
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6352, 3-phosphoinositide biosynthesis: PWY-6352
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: