Difference between revisions of "Protein-With-N-Terminal-Met"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] == * common name: ** a peptide with an...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] ==
* smiles:
+
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
+
 
* common name:
 
* common name:
** 3-oxo-docosapentaenoyl-CoA
+
** a peptide with an N-terminal L-methionine
* molecular weight:
+
** 1089.98   
+
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13443]]
+
* [[3.4.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13442]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a peptide with an N-terminal L-methionine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581097 71581097]
+
{{#set: consumed by=3.4.11.18-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73863 73863]
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J}}
+
{{#set: common name=3-oxo-docosapentaenoyl-CoA}}
+
{{#set: molecular weight=1089.98    }}
+
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA}}
+
{{#set: consumed by=RXN-13443}}
+
{{#set: produced by=RXN-13442}}
+

Latest revision as of 19:28, 21 March 2018

Metabolite Protein-With-N-Terminal-Met

  • common name:
    • a peptide with an N-terminal L-methionine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links