Difference between revisions of "PWY-6825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == * smiles: ** C(OP(=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6825 PWY-6825] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6825 PWY-6825] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
** InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+
** phosphatidylcholine biosynthesis V
* molecular weight:
+
** 346.21   
+
 
* Synonym(s):
 
* Synonym(s):
** 1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P
 
** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate
 
** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[IGPSYN-RXN]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.1.1.17-RXN]]
* [[PRAISOM-RXN]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[2.1.1.71-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-18_002350]]
 +
*** [[Ec-24_001260]]
 +
*** [[Ec-08_004940]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN4FS-2]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_001260]]
 +
*** [[Ec-08_004940]]
 +
*** [[Ec-18_002350]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266701 45266701]
+
{{#set: taxonomic range=TAX-33154}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58613 58613]
+
{{#set: common name=phosphatidylcholine biosynthesis V}}
* BIGG : 37317
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=3}}
** [http://www.genome.jp/dbget-bin/www_bget?C01302 C01302]
+
{{#set: completion rate=100.0}}
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)}}
+
{{#set: inchi key=InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K}}
+
{{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+
{{#set: molecular weight=346.21    }}
+
{{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P}}
+
{{#set: consumed by=IGPSYN-RXN}}
+
{{#set: produced by=PRAISOM-RXN}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-6825

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links