Difference between revisions of "TRIOSEPISOMERIZATION-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADH NADH] == * smiles: ** C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRIOSEPISOMERIZATION-RXN TRIOSEPISOMERIZATION-RXN] == * direction: ** REVERSIBLE * common name: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADH NADH] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRIOSEPISOMERIZATION-RXN TRIOSEPISOMERIZATION-RXN] ==
−
* smiles:
+
* direction:
−
** C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BOPGDPNILDQYTO-NNYOXOHSSA-L
+
 
* common name:
 
* common name:
−
** NADH
+
** triose-phosphate isomerase
−
* molecular weight:
+
** Triosephosphate isomerase
−
** 663.43   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/5.3.1.1 EC-5.3.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** NADH2
 
−
** dihydrodiphosphopyridine nucleotide
 
−
** diphosphopyridine nucleotide reduced
 
−
** dihydronicotinamide adenine dinucleotide
 
−
** nicotinamide adenine dinucleotide reduced
 
−
** NAD-reduced
 
−
** NADH+H+
 
−
** DPNH
 
−
** β-NADH
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11195]]
+
* With identifiers:
−
* [[TRANS-RXN0-277]]
+
** 1 [[GAP]][c] '''<=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
−
* [[RXN0-5330]]
+
* With common name(s):
−
* [[RXN-16632]]
+
** 1 D-glyceraldehyde 3-phosphate[c] '''<=>''' 1 glycerone phosphate[c]
−
* [[RXN-10062]]
+
 
−
* [[RXN-11478]]
+
== Genes associated with this reaction  ==
−
* [[1.5.1.20-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-3661]]
+
* Gene: [[Ec-08_000500]]
−
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN1G-488]]
+
*** Assignment: EC-NUMBER
−
* [[RXN1G-526]]
+
* Gene: [[Ec-24_000360]]
−
* [[RXN-9659]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-9658]]
+
*** Assignment: EC-NUMBER
−
* [[RXN-10911]]
+
** Source: [[orthology-aragem]]
−
* [[RXN-11482]]
+
** Source: [[orthology-aragem]]
−
* [[RXN-9635]]
+
* Gene: [[Ec-03_002790]]
−
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12754]]
+
*** Assignment: EC-NUMBER
−
* [[RXN-10657]]
+
* Gene: [[Ec-23_004160]]
−
* [[RXN-12753]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16628]]
+
*** Assignment: GO-TERM
−
* [[RXN-16620]]
+
== Pathways  ==
−
* [[RXN-16624]]
+
* [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
−
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37.]]
+
** '''8''' reactions found over '''10''' reactions in the full pathway
−
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
+
* [[P341-PWY]], glycolysis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY]
−
* [[RXN0-2145]]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN1G-395]]
+
* [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003]
−
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
+
** '''8''' reactions found over '''10''' reactions in the full pathway
−
* [[1.6.5.4-RXN]]
+
* [[PWY66-373]], sucrose degradation V (sucrose &alpha;-glucosidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373]
−
* [[RXN-9662]]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-9663]]
+
* [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
−
* [[RXN-9660]]
+
** '''13''' reactions found over '''13''' reactions in the full pathway
−
* [[RXN-9661]]
+
* [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
−
* [[RXN-12570]]
+
** '''12''' reactions found over '''12''' reactions in the full pathway
−
* [[RXN-9657]]
+
* [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
−
* [[RXN-10661]]
+
** '''10''' reactions found over '''14''' reactions in the full pathway
−
* [[NITRATE-REDUCTASE-NADH-RXN]]
+
* [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
−
* [[RXN-9510]]
+
** '''13''' reactions found over '''13''' reactions in the full pathway
−
* [[RXN-9558]]
+
* [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
−
* [[RXN-13417]]
+
** '''10''' reactions found over '''10''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
−
* [[RXN-8001]]
+
** '''11''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-14116]]
+
* [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
−
* [[1.2.1.65-RXN]]
+
** '''11''' reactions found over '''12''' reactions in the full pathway
−
* [[RXN-17115]]
+
* [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
−
* [[RXN-12490]]
+
** '''10''' reactions found over '''12''' reactions in the full pathway
−
* [[RXN66-479]]
+
== Reconstruction information  ==
−
* [[RXN-17794]]
+
* Category: [[orthology]]
−
* [[RXN-17777]]
+
** Source: [[orthology-aragem]]
−
* [[RXN-17790]]
+
*** Tool: [[pantograph]]
−
* [[RXN-12705]]
+
* Category: [[annotation]]
−
* [[1.8.1.4-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-3]]
+
*** Tool: [[pathwaytools]]
−
* [[1.5.1.9-RXN]]
+
−
* [[RXN-17798]]
+
−
* [[RXN-2902]]
+
−
* [[QUINATE-5-DEHYDROGENASE-RXN]]
+
−
* [[PREPHENATEDEHYDROG-RXN]]
+
−
* [[RXN-905]]
+
−
* [[RXN-10715]]
+
−
* [[RXN-12507]]
+
−
* [[PYRUVDEH-RXN]]
+
−
* [[RXN-7682]]
+
−
* [[RXN-12750]]
+
−
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
+
−
* [[1.5.1.15-RXN]]
+
−
* [[PYRNUTRANSHYDROGEN-RXN]]
+
−
* [[2OXOGLUTARATEDEH-RXN]]
+
−
* [[GLYCOLALD-DEHYDROG-RXN]]
+
−
* [[RXN-37]]
+
−
* [[RXN-7745]]
+
−
* [[OHACYL-COA-DEHYDROG-RXN]]
+
−
* [[RXN-11213]]
+
−
* [[RXN66-472]]
+
−
* [[RXN-1884]]
+
−
* [[HISTALDEHYD-RXN]]
+
−
* [[RXN-10698]]
+
−
* [[RXN66-476]]
+
−
* [[RXN-12693]]
+
−
* [[RXN-17781]]
+
−
* [[RXN-16559]]
+
−
* [[RXN-3341]]
+
−
* [[RXN-14271]]
+
−
* [[1.1.1.39-RXN]]
+
−
* [[RXN-13158]]
+
−
* [[DHBDEHYD-RXN]]
+
−
* [[RXN-16136]]
+
−
* [[UGD-RXN]]
+
−
* [[RXN-10702]]
+
−
* [[RXN-10703]]
+
−
* [[RXN-10780]]
+
−
* [[1.2.1.27-RXN]]
+
−
* [[RXN-12789]]
+
−
* [[ALDHDEHYDROG-RXN]]
+
−
* [[RXN-7790]]
+
−
* [[RXN-13414]]
+
−
* [[RXN-14986]]
+
−
* [[RXN0-1132]]
+
−
* [[RXN-17786]]
+
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
−
* [[RXN0-5248]]
+
−
* [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
+
−
* [[CYCLOHEXADIENYL-DEHYDROGENASE-RXN]]
+
−
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
−
* [[R222-RXN]]
+
−
* [[1.2.1.25-RXN]]
+
−
* [[RXN-10089]]
+
−
* [[RXN-11245]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN-7719]]
+
−
* [[NADH-DEHYDROG-A-RXN]]
+
−
* [[GCVMULTI-RXN]]
+
−
* [[PHENDEHYD-RXN]]
+
−
* [[RXN0-901]]
+
−
* [[RXN-7644]]
+
−
* [[RXN-7716]]
+
−
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
+
−
* [[RXN0-2044]]
+
−
* [[IMP-DEHYDROG-RXN]]
+
−
* [[RXN-14280]]
+
−
* [[GLYCOLATE-REDUCTASE-RXN]]
+
−
* [[MANNPDEHYDROG-RXN]]
+
−
* [[ALANINE-DEHYDROGENASE-RXN]]
+
−
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
+
−
* [[NADH-DEHYDROGENASE-RXN]]
+
−
* [[RXN-8629]]
+
−
* [[RXN-11662]]
+
−
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
−
* [[L-AMINO-ACID-DEHYDROGENASE-RXN-TYR/NAD/WATER//P-HYDROXY-PHENYLPYRUVATE/AMMONIUM/NADH/PROTON.61.]]
+
−
* [[RETINOL-DEHYDROGENASE-RXN]]
+
−
* [[HISTOLDEHYD-RXN]]
+
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
−
* [[1.1.1.178-RXN]]
+
−
* [[MALATE-DEH-RXN]]
+
−
* [[2KETO-3METHYLVALERATE-RXN]]
+
−
* [[1.1.1.8-RXN]]
+
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
−
* [[RXN-1302]]
+
−
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
−
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
−
* [[1.1.1.145-RXN]]
+
−
* [[BADH-RXN]]
+
−
* [[RXN-16133]]
+
−
* [[GAPOXNPHOSPHN-RXN]]
+
−
* [[FUMARATE-REDUCTASE-NADH-RXN]]
+
−
* [[PGLYCDEHYDROG-RXN]]
+
−
* [[GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.]]
+
−
* [[1.3.1.9-RXN]]
+
−
* [[RXN0-276]]
+
−
* [[RXN-14225]]
+
−
* [[RXN-14224]]
+
−
* [[L-LACTATE-DEHYDROGENASE-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 58-68-4
+
* RHEA:
−
* BIGG : 33484
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18585 18585]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604869 21604869]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01015 R01015]
−
* HMDB : HMDB01487
+
* UNIPROT:
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P19118 P19118]
−
** [http://www.genome.jp/dbget-bin/www_bget?C00004 C00004]
+
** [http://www.uniprot.org/uniprot/P21820 P21820]
−
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/P48501 P48501]
−
** [http://www.chemspider.com/Chemical-Structure.10239197.html 10239197]
+
** [http://www.uniprot.org/uniprot/P62002 P62002]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/O27120 O27120]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57945 57945]
+
** [http://www.uniprot.org/uniprot/P27876 P27876]
−
* METABOLIGHTS : MTBLC57945
+
** [http://www.uniprot.org/uniprot/Q9PMQ6 Q9PMQ6]
−
{{#set: smiles=C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
** [http://www.uniprot.org/uniprot/P19583 P19583]
−
{{#set: inchi key=InChIKey=BOPGDPNILDQYTO-NNYOXOHSSA-L}}
+
** [http://www.uniprot.org/uniprot/Q9UXX2 Q9UXX2]
−
{{#set: common name=NADH}}
+
** [http://www.uniprot.org/uniprot/P47721 P47721]
−
{{#set: molecular weight=663.43    }}
+
** [http://www.uniprot.org/uniprot/P47670 P47670]
−
{{#set: common name=NADH2|dihydrodiphosphopyridine nucleotide|diphosphopyridine nucleotide reduced|dihydronicotinamide adenine dinucleotide|nicotinamide adenine dinucleotide reduced|NAD-reduced|NADH+H+|DPNH|&beta;-NADH}}
+
** [http://www.uniprot.org/uniprot/P50918 P50918]
−
{{#set: consumed by=RXN-11195|TRANS-RXN0-277|RXN0-5330|RXN-16632|RXN-10062|RXN-11478|1.5.1.20-RXN|RXN-3661|GLUTAMATE-SYNTHASE-NADH-RXN|RXN1G-488|RXN1G-526|RXN-9659|RXN-9658|RXN-10911|RXN-11482|RXN-9635|ENOYL-ACP-REDUCT-NADH-RXN|RXN-12754|RXN-10657|RXN-12753|RXN-16628|RXN-16620|RXN-16624|TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37.|1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.|RXN0-2145|RXN1G-395|CYTOCHROME-B5-REDUCTASE-RXN|1.6.5.4-RXN|RXN-9662|RXN-9663|RXN-9660|RXN-9661|RXN-12570|RXN-9657|RXN-10661|NITRATE-REDUCTASE-NADH-RXN|RXN-9510|RXN-9558|RXN-13417}}
+
** [http://www.uniprot.org/uniprot/P43727 P43727]
−
{{#set: produced by=RXN-8001|RXN-14116|1.2.1.65-RXN|RXN-17115|RXN-12490|RXN66-479|RXN-17794|RXN-17777|RXN-17790|RXN-12705|1.8.1.4-RXN|RXN66-3|1.5.1.9-RXN|RXN-17798|RXN-2902|QUINATE-5-DEHYDROGENASE-RXN|PREPHENATEDEHYDROG-RXN|RXN-905|RXN-10715|RXN-12507|PYRUVDEH-RXN|RXN-7682|RXN-12750|2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN|1.5.1.15-RXN|PYRNUTRANSHYDROGEN-RXN|2OXOGLUTARATEDEH-RXN|GLYCOLALD-DEHYDROG-RXN|RXN-37|RXN-7745|OHACYL-COA-DEHYDROG-RXN|RXN-11213|RXN66-472|RXN-1884|HISTALDEHYD-RXN|RXN-10698|RXN66-476|RXN-12693|RXN-17781|RXN-16559|RXN-3341|RXN-14271|1.1.1.39-RXN|RXN-13158|DHBDEHYD-RXN|RXN-16136|UGD-RXN|RXN-10702|RXN-10703|RXN-10780|1.2.1.27-RXN|RXN-12789|ALDHDEHYDROG-RXN|RXN-7790|RXN-13414|RXN-14986|RXN0-1132|RXN-17786|2-KETO-ADIPATE-DEHYDROG-RXN|RXN0-5248|3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN|CYCLOHEXADIENYL-DEHYDROGENASE-RXN|GDP-MANNOSE-6-DEHYDROGENASE-RXN|R222-RXN|1.2.1.25-RXN|RXN-10089|RXN-11245}}
+
** [http://www.uniprot.org/uniprot/Q58923 Q58923]
−
{{#set: reversible reaction associated=RXN-7719|NADH-DEHYDROG-A-RXN|GCVMULTI-RXN|PHENDEHYD-RXN|RXN0-901|RXN-7644|RXN-7716|GLUTAMATE-DEHYDROGENASE-RXN|RXN0-2044|IMP-DEHYDROG-RXN|RXN-14280|GLYCOLATE-REDUCTASE-RXN|MANNPDEHYDROG-RXN|ALANINE-DEHYDROGENASE-RXN|RR-BUTANEDIOL-DEHYDROGENASE-RXN|NADH-DEHYDROGENASE-RXN|RXN-8629|RXN-11662|L-IDITOL-2-DEHYDROGENASE-RXN|L-AMINO-ACID-DEHYDROGENASE-RXN-TYR/NAD/WATER//P-HYDROXY-PHENYLPYRUVATE/AMMONIUM/NADH/PROTON.61.|RETINOL-DEHYDROGENASE-RXN|HISTOLDEHYD-RXN|RIBITOL-2-DEHYDROGENASE-RXN|1.1.1.178-RXN|MALATE-DEH-RXN|2KETO-3METHYLVALERATE-RXN|1.1.1.8-RXN|MYO-INOSITOL-2-DEHYDROGENASE-RXN|RXN-1302|3-ISOPROPYLMALDEHYDROG-RXN|BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN|1.1.1.145-RXN|BADH-RXN|RXN-16133|GAPOXNPHOSPHN-RXN|FUMARATE-REDUCTASE-NADH-RXN|PGLYCDEHYDROG-RXN|GCVMULTI-RXN-GLY/THF/NAD//METHYLENE-THF/AMMONIUM/CARBON-DIOXIDE/NADH.56.|1.3.1.9-RXN|RXN0-276|RXN-14225|RXN-14224|L-LACTATE-DEHYDROGENASE-RXN}}
+
** [http://www.uniprot.org/uniprot/O28965 O28965]
 +
** [http://www.uniprot.org/uniprot/Q59182 Q59182]
 +
** [http://www.uniprot.org/uniprot/O59536 O59536]
 +
** [http://www.uniprot.org/uniprot/P36204 P36204]
 +
** [http://www.uniprot.org/uniprot/Q9JW31 Q9JW31]
 +
** [http://www.uniprot.org/uniprot/P04828 P04828]
 +
** [http://www.uniprot.org/uniprot/P00943 P00943]
 +
** [http://www.uniprot.org/uniprot/P00942 P00942]
 +
** [http://www.uniprot.org/uniprot/P00940 P00940]
 +
** [http://www.uniprot.org/uniprot/P60175 P60175]
 +
** [http://www.uniprot.org/uniprot/P0A858 P0A858]
 +
** [http://www.uniprot.org/uniprot/P60174 P60174]
 +
** [http://www.uniprot.org/uniprot/P00941 P00941]
 +
** [http://www.uniprot.org/uniprot/P15426 P15426]
 +
** [http://www.uniprot.org/uniprot/P17751 P17751]
 +
** [http://www.uniprot.org/uniprot/P00939 P00939]
 +
** [http://www.uniprot.org/uniprot/P12863 P12863]
 +
** [http://www.uniprot.org/uniprot/P07669 P07669]
 +
** [http://www.uniprot.org/uniprot/P35144 P35144]
 +
** [http://www.uniprot.org/uniprot/P48494 P48494]
 +
** [http://www.uniprot.org/uniprot/Q7M4X7 Q7M4X7]
 +
** [http://www.uniprot.org/uniprot/P29613 P29613]
 +
** [http://www.uniprot.org/uniprot/P30741 P30741]
 +
** [http://www.uniprot.org/uniprot/Q01893 Q01893]
 +
** [http://www.uniprot.org/uniprot/P48499 P48499]
 +
** [http://www.uniprot.org/uniprot/P48496 P48496]
 +
** [http://www.uniprot.org/uniprot/P46226 P46226]
 +
** [http://www.uniprot.org/uniprot/P46225 P46225]
 +
** [http://www.uniprot.org/uniprot/P48492 P48492]
 +
** [http://www.uniprot.org/uniprot/Q56738 Q56738]
 +
** [http://www.uniprot.org/uniprot/Q7LZE5 Q7LZE5]
 +
** [http://www.uniprot.org/uniprot/P46711 P46711]
 +
** [http://www.uniprot.org/uniprot/O32757 O32757]
 +
** [http://www.uniprot.org/uniprot/O74067 O74067]
 +
** [http://www.uniprot.org/uniprot/P48491 P48491]
 +
{{#set: direction=REVERSIBLE}}
 +
{{#set: common name=triose-phosphate isomerase}}
 +
{{#set: common name=Triosephosphate isomerase}}
 +
{{#set: ec number=EC-5.3.1.1}}
 +
{{#set: gene associated=Ec-08_000500|Ec-24_000360|Ec-03_002790|Ec-23_004160}}
 +
{{#set: in pathway=PWY-1042|P341-PWY|PWY-7003|PWY66-373|GLUCONEO-PWY|GLYCOLYSIS|PWY-6142|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|PWY66-399}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:28, 21 March 2018

Reaction TRIOSEPISOMERIZATION-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • triose-phosphate isomerase
    • Triosephosphate isomerase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1042, glycolysis IV (plant cytosol): PWY-1042
    • 8 reactions found over 10 reactions in the full pathway
  • P341-PWY, glycolysis V (Pyrococcus): P341-PWY
    • 6 reactions found over 9 reactions in the full pathway
  • PWY-7003, glycerol degradation to butanol: PWY-7003
    • 8 reactions found over 10 reactions in the full pathway
  • PWY66-373, sucrose degradation V (sucrose α-glucosidase): PWY66-373
    • 2 reactions found over 5 reactions in the full pathway
  • GLUCONEO-PWY, gluconeogenesis I: GLUCONEO-PWY
    • 13 reactions found over 13 reactions in the full pathway
  • GLYCOLYSIS, glycolysis I (from glucose 6-phosphate): GLYCOLYSIS
    • 12 reactions found over 12 reactions in the full pathway
  • PWY-6142, gluconeogenesis II (Methanobacterium thermoautotrophicum): PWY-6142
    • 10 reactions found over 14 reactions in the full pathway
  • CALVIN-PWY, Calvin-Benson-Bassham cycle: CALVIN-PWY
    • 13 reactions found over 13 reactions in the full pathway
  • ANAGLYCOLYSIS-PWY, glycolysis III (from glucose): ANAGLYCOLYSIS-PWY
    • 10 reactions found over 10 reactions in the full pathway
  • PWY-5484, glycolysis II (from fructose 6-phosphate): PWY-5484
    • 11 reactions found over 11 reactions in the full pathway
  • P185-PWY, formaldehyde assimilation III (dihydroxyacetone cycle): P185-PWY
    • 11 reactions found over 12 reactions in the full pathway
  • PWY66-399, gluconeogenesis III: PWY66-399
    • 10 reactions found over 12 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRIOSEPISOMERIZATION-RXN&oldid=27171"