Difference between revisions of "ISOPENICILLIN-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] == * common name: ** an [Fe-S cluster bi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == * smiles: ** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == |
+ | * smiles: | ||
+ | ** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-])) | ||
+ | * inchi key: | ||
+ | ** InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** isopenicillin N |
+ | * molecular weight: | ||
+ | ** 358.388 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.21.3.1-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244809 25244809] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58399 58399] | ||
+ | * METABOLIGHTS : MTBLC58399 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05557 C05557] | ||
+ | {{#set: smiles=CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))}} | ||
+ | {{#set: inchi key=InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M}} | ||
+ | {{#set: common name=isopenicillin N}} | ||
+ | {{#set: molecular weight=358.388 }} | ||
+ | {{#set: produced by=1.21.3.1-RXN}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite ISOPENICILLIN-N
- smiles:
- CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))
- inchi key:
- InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M
- common name:
- isopenicillin N
- molecular weight:
- 358.388
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))" cannot be used as a page name in this wiki.