Difference between revisions of "PWY-7117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4479 TAX-4479]
−
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
 
* common name:
 
* common name:
−
** 18-hydroxyoleoyl-CoA
+
** C4 photosynthetic carbon assimilation cycle, PEPCK type
−
* molecular weight:
+
−
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
+
** C4 photosynthesis, PEPCK type
−
** ω-hydroxyoleoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-16117]]
+
'''9''' reactions found over '''10''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ALANINE-AMINOTRANSFERASE-RXN]]
−
* [[RXN-16402]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_011040]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-03_003270]]
 +
*** [[Ec-01_007480]]
 +
*** [[Ec-23_003500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MALIC-NADP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_003680]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-19_002930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-18_001310]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-13697]]
 +
** 3 associated gene(s):
 +
*** [[Ec-01_007480]]
 +
*** [[Ec-23_003500]]
 +
*** [[Ec-03_003270]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13698]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_011040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-5224]]
 +
** 8 associated gene(s):
 +
*** [[Ec-03_001960]]
 +
*** [[Ec-10_002770]]
 +
*** [[Ec-06_004120]]
 +
*** [[Ec-05_001290]]
 +
*** [[Ec-27_005680]]
 +
*** [[Ec-07_004610]]
 +
*** [[Ec-22_001150]]
 +
*** [[Ec-16_004700]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MALATE-DEHYDROGENASE-NADP+-RXN MALATE-DEHYDROGENASE-NADP+-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3398}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: taxonomic range=TAX-4479}}
−
* CHEBI:
+
{{#set: common name=C4 photosynthetic carbon assimilation cycle, PEPCK type}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
{{#set: common name=C4 photosynthesis, PEPCK type}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=9}}
−
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
{{#set: total reaction=10}}
−
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
{{#set: completion rate=90.0}}
−
{{#set: molecular weight=1043.952    }}
+
−
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16117}}
+
−
{{#set: produced by=RXN-16402}}
+

Latest revision as of 20:28, 21 March 2018

Pathway PWY-7117

  • taxonomic range:
  • common name:
    • C4 photosynthetic carbon assimilation cycle, PEPCK type
  • Synonym(s):
    • C4 photosynthesis, PEPCK type

Reaction(s) found

9 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7117&oldid=27183"