Difference between revisions of "PWY-7173"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7173 PWY-7173] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7173 PWY-7173] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
* inchi key:
+
** InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J
+
 
* common name:
 
* common name:
** (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** quercetin triglucoside biosynthesis
* molecular weight:
+
** 1104.05   
+
 
* Synonym(s):
 
* Synonym(s):
** (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17113]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN1F-462]]
* [[RXN-17112]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-14_000870]]
 +
*** [[Ec-04_004610]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14000 RXN-14000]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14001 RXN-14001]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-3803}}
{{#set: inchi key=InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J}}
+
{{#set: common name=quercetin triglucoside biosynthesis}}
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: reaction found=1}}
{{#set: molecular weight=1104.05    }}
+
{{#set: total reaction=3}}
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: completion rate=33.0}}
{{#set: consumed by=RXN-17113}}
+
{{#set: produced by=RXN-17112}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-7173

  • taxonomic range:
  • common name:
    • quercetin triglucoside biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links