Difference between revisions of "CPD-18491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBONUCLEOSIDE-DIP-REDUCTII-RXN RIBONUCLEOSIDE-DIP-REDUCTII-RXN] == * direction: ** LEFT-TO-RIGHT *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBONUCLEOSIDE-DIP-REDUCTII-RXN RIBONUCLEOSIDE-DIP-REDUCTII-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 +
* inchi key:
 +
** InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J
 
* common name:
 
* common name:
** Ribonucleoside-diphosphate reductase small chain
+
** (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
+
* molecular weight:
** EsV-1-128
+
** 1104.05   
** EsV-1-180
+
* ec number:
+
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17113]]
** 1 [[CDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[DCDP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17112]]
** 1 CDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 dCDP[c] '''+''' 1 H2O[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-19_000440]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-06_005120]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-06_005570]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-21_002920]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
* [[Ec-11_002170]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
** '''14''' reactions found over '''17''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
+
{{#set: inchi key=InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J}}
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
+
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
{{#set: common name=EsV-1-128}}
+
{{#set: molecular weight=1104.05    }}
{{#set: common name=EsV-1-180}}
+
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
{{#set: ec number=EC-1.17.4.1}}
+
{{#set: consumed by=RXN-17113}}
{{#set: gene associated=Ec-19_000440|Ec-06_005120|Ec-06_005570|Ec-21_002920|Ec-11_002170}}
+
{{#set: produced by=RXN-17112}}
{{#set: in pathway=PWY0-166}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:29, 21 March 2018

Metabolite CPD-18491

  • smiles:
    • CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J
  • common name:
    • (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
  • molecular weight:
    • 1104.05
  • Synonym(s):
    • (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.