Difference between revisions of "CPD-13914"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-183963]
+
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-183924]
+
* inchi key:
 +
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
 
* common name:
 
* common name:
** Entner-Doudoroff pathway III (semi-phosphorylative)
+
** cyclic-2,3-O-oxalyl-L-threonate
 +
* molecular weight:
 +
** 189.101   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,3-cyclic oxalyl theronolactone
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''5''' reaction(s) found
+
* [[RXN-12872]]
** [[KDPGALDOL-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[3PGAREARR-RXN]]
+
* [[RXN-12869]]
** [[PEPDEPHOS-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[2PGADEHYDRAT-RXN]]
+
** [[GLUCONOLACT-RXN]]
+
== Reaction(s) not found ==
+
* '''4''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE-1-DEHYDROGENASE-NADP+-RXN GLUCOSE-1-DEHYDROGENASE-NADP+-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-3443 RXN-3443]
+
** [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-DEHYDRATASE-RXN GLUCONATE-DEHYDRATASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-183963}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-183924}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
{{#set: common name=Entner-Doudoroff pathway III (semi-phosphorylative)}}
+
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
{{#set: reaction found=5}}
+
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
{{#set: reaction not found=4}}
+
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
 +
{{#set: molecular weight=189.101    }}
 +
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
 +
{{#set: consumed by=RXN-12872}}
 +
{{#set: produced by=RXN-12869}}

Latest revision as of 19:29, 21 March 2018

Metabolite CPD-13914

  • smiles:
    • C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
  • inchi key:
    • InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
  • common name:
    • cyclic-2,3-O-oxalyl-L-threonate
  • molecular weight:
    • 189.101
  • Synonym(s):
    • 2,3-cyclic oxalyl theronolactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)" cannot be used as a page name in this wiki.