Difference between revisions of "GALACTOSE-1P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-26_000190 == * left end position: ** 376382 * transcription direction: ** NEGATIVE * right end position: ** 382141 * centisome position: ** 5.7171...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L |
− | * | + | * common name: |
− | ** | + | ** α-D-galactose 1-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-Gal-1-P |
− | ** | + | ** α-D-galactopyranose 1-phosphate |
+ | ** galactose-1-P | ||
+ | ** D-galactose-1-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GALACTURIDYLYLTRANS-RXN]] | |
− | + | * [[GALACTOKIN-RXN]] | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2255-14-3 |
− | {{#set: | + | * BIGG : 35001 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098639 7098639] |
− | {{#set: common name= | + | * HMDB : HMDB00645 |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00446 C00446] | |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5447153.html 5447153] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58336 58336] | ||
+ | * METABOLIGHTS : MTBLC58336 | ||
+ | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L}} | ||
+ | {{#set: common name=α-D-galactose 1-phosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=α-D-Gal-1-P|α-D-galactopyranose 1-phosphate|galactose-1-P|D-galactose-1-phosphate}} | ||
+ | {{#set: reversible reaction associated=GALACTURIDYLYLTRANS-RXN|GALACTOKIN-RXN}} |
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite GALACTOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L
- common name:
- α-D-galactose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- α-D-Gal-1-P
- α-D-galactopyranose 1-phosphate
- galactose-1-P
- D-galactose-1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2255-14-3
- BIGG : 35001
- PUBCHEM:
- HMDB : HMDB00645
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58336
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.