Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chitodextrins Chitodextrins] == * common name: ** a chitodextrin * Synonym(s): ** a chtin fragm...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chitodextrins Chitodextrins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
 +
* smiles:
 +
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
 +
* inchi key:
 +
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
 
* common name:
 
* common name:
−
** a chitodextrin
+
** α,ω-9Z-octadecenedioate
 +
* molecular weight:
 +
** 310.433   
 
* Synonym(s):
 
* Synonym(s):
−
** a chtin fragment
+
** α,ω-9Z-octadecenedioic acid
−
** a chitin oligosaccharide
+
** 1,18-9Z-octadecenedioic acid
 +
** octadecenedioate
 +
** 18-carboxyl oleate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12624]]
+
* [[RXN-16418]]
−
* [[RXN-12623]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.2.1.14-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a chitodextrin}}
+
* PUBCHEM:
−
{{#set: common name=a chtin fragment|a chitin oligosaccharide}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
−
{{#set: consumed by=RXN-12624|RXN-12623}}
+
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
−
{{#set: produced by=3.2.1.14-RXN}}
+
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
 +
{{#set: common name=α,ω-9Z-octadecenedioate}}
 +
{{#set: molecular weight=310.433    }}
 +
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
 +
{{#set: consumed by=RXN-16418}}

Latest revision as of 19:29, 21 March 2018

Metabolite OCTADEC-9-ENE-118-DIOIC-ACID

  • smiles:
    • C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
  • inchi key:
    • InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
  • common name:
    • α,ω-9Z-octadecenedioate
  • molecular weight:
    • 310.433
  • Synonym(s):
    • α,ω-9Z-octadecenedioic acid
    • 1,18-9Z-octadecenedioic acid
    • octadecenedioate
    • 18-carboxyl oleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=OCTADEC-9-ENE-118-DIOIC-ACID&oldid=27248"