Difference between revisions of "CODH-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** reductive acetyl coenzyme A pathway I (homoacetogenic bacteria) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Wood pathway | ||
+ | ** acetate synthesis | ||
+ | ** acetyl-CoA pathway | ||
+ | ** carbon monoxide dehydrogenase pathway | ||
+ | ** carbon fixation | ||
+ | ** CO2 fixation | ||
+ | ** Ljungdahl-Wood pathway | ||
+ | ** Wood-Ljungdahl pathway | ||
+ | ** reductive acetyl CoA pathway | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''9''' reactions in the full pathway | |
− | * [[ | + | * [[1.5.1.20-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Ec-03_002180]] | ||
+ | *** [[Ec-08_003880]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[FORMATETHFLIG-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-25_001900]] | ||
+ | *** [[Ec-01_009540]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[METHENYLTHFCYCLOHYDRO-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-14_004070]] | ||
+ | *** [[Ec-15_001370]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[METHYLENETHFDEHYDROG-NADP-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-15_001370]] | ||
+ | *** [[Ec-14_004070]] | ||
+ | *** [[Ec-07_007470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-5061]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.2.7.4-RXN 1.2.7.4-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSYNCLTH-RXN ACETYLSYNCLTH-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=FORMATE-DEHYDROGENASE-NADP+-RXN FORMATE-DEHYDROGENASE-NADP+-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=METHCOCLTH-RXN METHCOCLTH-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=reductive acetyl coenzyme A pathway I (homoacetogenic bacteria)}} | |
− | + | {{#set: common name=Wood pathway|acetate synthesis|acetyl-CoA pathway|carbon monoxide dehydrogenase pathway|carbon fixation|CO2 fixation|Ljungdahl-Wood pathway|Wood-Ljungdahl pathway|reductive acetyl CoA pathway}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=56.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Pathway CODH-PWY
- taxonomic range:
- common name:
- reductive acetyl coenzyme A pathway I (homoacetogenic bacteria)
- Synonym(s):
- Wood pathway
- acetate synthesis
- acetyl-CoA pathway
- carbon monoxide dehydrogenase pathway
- carbon fixation
- CO2 fixation
- Ljungdahl-Wood pathway
- Wood-Ljungdahl pathway
- reductive acetyl CoA pathway
Reaction(s) found
5 reactions found over 9 reactions in the full pathway
- 1.5.1.20-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- FORMATETHFLIG-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- METHENYLTHFCYCLOHYDRO-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- METHYLENETHFDEHYDROG-NADP-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-5061
- 0 associated gene:
- 1 reconstruction source(s) associated: