Difference between revisions of "CPD-17814"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J |
* common name: | * common name: | ||
| − | ** | + | ** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1015.898 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16559]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16558]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456] |
| − | + | {{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} | |
| − | + | {{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}} | |
| − | + | {{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=1015.898 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-16559}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN-16558}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: consumed by=RXN- | + | |
Latest revision as of 20:29, 21 March 2018
Contents
Metabolite CPD-17814
- smiles:
- CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- inchi key:
- InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
- common name:
- (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
- molecular weight:
- 1015.898
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.
