Difference between revisions of "RXN-12518"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12518 RXN-12518] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12518 RXN-12518] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCCCCCCCC([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M
+
 
* common name:
 
* common name:
−
** linoleate
+
** acyl-CoA oxidase, partial
−
* molecular weight:
+
** acyl-CoA oxidase
−
** 279.442   
+
** Acyl-CoA oxidase/dehydrogenase, central domain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** cis,cis-9,12-octadecadienoate
 
−
** 9-cis,12-cis-octadecadienoate
 
−
** linoleic acid
 
−
** 9,12-linoleic acid
 
−
** (9Z,12Z)-octadeca-9,12-dienoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R07063]]
+
* With identifiers:
−
* [[RXN-9673]]
+
** 1 [[cis-5-enoyl-CoA]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[trans-2-cis-5-dienoyl-CoA]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[LINOLEOYL-RXN]]
+
** 1 a cis-5-enoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 a trans2,cis-5-dienoyl-CoA[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=281243 281243]
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
* CAS : 60-33-3
+
{{#set: common name=acyl-CoA oxidase}}
−
* Wikipedia : Linoleic_acid
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
* LIPID_MAPS : LMFA01030120
+
{{#set: ec number=EC-1.3.3.6}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-22_002920|Ec-08_006390|Ec-26_004320}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460332 5460332]
+
{{#set: in pathway=PWY-6837}}
−
* HMDB : HMDB00673
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01595 C01595]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573899.html 4573899]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30245 30245]
+
−
* METABOLIGHTS : MTBLC30245
+
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M}}
+
−
{{#set: common name=linoleate}}
+
−
{{#set: molecular weight=279.442    }}
+
−
{{#set: common name=cis,cis-9,12-octadecadienoate|9-cis,12-cis-octadecadienoate|linoleic acid|9,12-linoleic acid|(9Z,12Z)-octadeca-9,12-dienoate}}
+
−
{{#set: consumed by=R07063|RXN-9673}}
+
−
{{#set: produced by=LINOLEOYL-RXN}}
+

Latest revision as of 20:29, 21 March 2018

Reaction RXN-12518

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
    • Acyl-CoA oxidase/dehydrogenase, central domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6837, fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): PWY-6837
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12518&oldid=27310"