Difference between revisions of "CPD-10267"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * smiles: ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J |
* common name: | * common name: | ||
| − | ** | + | ** decanoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 917.754 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13614]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14274]] | ||
== External links == | == External links == | ||
| + | * BIGG : 45478 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244140 25244140] |
| − | {{#set: smiles= | + | * HMDB : HMDB06404 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05274 C05274] |
| − | {{#set: molecular weight= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61430 61430] |
| − | + | * METABOLIGHTS : MTBLC61430 | |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| + | {{#set: inchi key=InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J}} | ||
| + | {{#set: common name=decanoyl-CoA}} | ||
| + | {{#set: molecular weight=917.754 }} | ||
| + | {{#set: produced by=RXN-13614}} | ||
| + | {{#set: reversible reaction associated=RXN-14274}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite CPD-10267
- smiles:
- CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J
- common name:
- decanoyl-CoA
- molecular weight:
- 917.754
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 45478
- PUBCHEM:
- HMDB : HMDB06404
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61430
"CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
