|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOGLUCMUT-RXN PHOSPHOGLUCMUT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCC=CCC=CCCCCCCCC([O-])=O |
| + | * inchi key: |
| + | ** InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M |
| * common name: | | * common name: |
− | ** Phosphomannomutase/phosphoglucomutase | + | ** linoleate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/5.4.2.2 EC-5.4.2.2] | + | ** 279.442 |
| * Synonym(s): | | * Synonym(s): |
| + | ** cis,cis-9,12-octadecadienoate |
| + | ** 9-cis,12-cis-octadecadienoate |
| + | ** linoleic acid |
| + | ** 9,12-linoleic acid |
| + | ** (9Z,12Z)-octadeca-9,12-dienoate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[R07063]] |
− | ** 1 [[GLC-1-P]][c] '''<=>''' 1 [[D-glucopyranose-6-phosphate]][c]
| + | * [[RXN-9673]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 α-D-glucopyranose 1-phosphate[c] '''<=>''' 1 D-glucopyranose 6-phosphate[c]
| + | * [[LINOLEOYL-RXN]] |
− | | + | == Reaction(s) of unknown directionality == |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-17_001480]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238] | + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
| + | |
− | ** '''3''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7343]], UDP-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-622]], starch biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-622 PWY-622]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6731]], starch degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[GLUCOSE1PMETAB-PWY]], glucose and glucose-1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY] | + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6737]], starch degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-2723]], trehalose degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-5940]], streptomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5940 PWY-5940]
| + | |
− | ** '''2''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[GLYCOGENSYNTH-PWY]], glycogen biosynthesis I (from ADP-D-Glucose): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENSYNTH-PWY GLYCOGENSYNTH-PWY]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5941]], glycogen degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941]
| + | |
− | ** '''1''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5661]], GDP-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5661 PWY-5661]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * NCI: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23536 23536] | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=281243 281243] |
− | * PIR:
| + | * CAS : 60-33-3 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A41801 A41801]
| + | * Wikipedia : Linoleic_acid |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A53614 A53614] | + | * LIPID_MAPS : LMFA01030120 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B53614 B53614]
| + | * PUBCHEM: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E70650 E70650] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460332 5460332] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G64803 G64803] | + | * HMDB : HMDB00673 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G81947 G81947] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I39487 I39487] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01595 C01595] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I41215 I41215]
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRB PMRB]
| + | ** [http://www.chemspider.com/Chemical-Structure.4573899.html 4573899] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRBI PMRBI] | + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRT PMRT]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30245 30245] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S10741 S10741]
| + | * METABOLIGHTS : MTBLC30245 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S39397 S39397]
| + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC([O-])=O}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41199 S41199]
| + | {{#set: inchi key=InChIKey=OYHQOLUKZRVURQ-HZJYTTRNSA-M}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41200 S41200]
| + | {{#set: common name=linoleate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S76847 S76847]
| + | {{#set: molecular weight=279.442 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78440 S78440]
| + | {{#set: common name=cis,cis-9,12-octadecadienoate|9-cis,12-cis-octadecadienoate|linoleic acid|9,12-linoleic acid|(9Z,12Z)-octadeca-9,12-dienoate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04326 T04326]
| + | {{#set: consumed by=R07063|RXN-9673}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04327 T04327]
| + | {{#set: produced by=LINOLEOYL-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T12574 T12574]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T52656 T52656]
| + | |
− | * LIGAND-RXN: | + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00959 R00959] | + | |
− | * UNIPROT: | + | |
− | ** [http://www.uniprot.org/uniprot/P36871 P36871] | + | |
− | ** [http://www.uniprot.org/uniprot/P40390 P40390]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40391 P40391] | + | |
− | ** [http://www.uniprot.org/uniprot/P95090 P95090] | + | |
− | ** [http://www.uniprot.org/uniprot/P36938 P36938]
| + | |
− | ** [http://www.uniprot.org/uniprot/P57002 P57002]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38569 P38569] | + | |
− | ** [http://www.uniprot.org/uniprot/P31120 P31120]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00949 P00949]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38652 P38652]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2K5 Q7M2K5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16106 Q16106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33401 P33401]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37012 P37012]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74643 P74643]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51847 Q51847]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93804 P93804]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93805 P93805]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93262 P93262]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SCY0 Q9SCY0]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Phosphomannomutase/phosphoglucomutase}} | + | |
− | {{#set: ec number=EC-5.4.2.2}} | + | |
− | {{#set: gene associated=Ec-17_001480}} | + | |
− | {{#set: in pathway=PWY-7238|PWY-5384|GLYCOCAT-PWY|PWY-7343|PWY-3801|PWY-622|PWY-6731|GLUCOSE1PMETAB-PWY|PWY-6737|PWY-6317|PWY-2723|PWY66-422|PWY-5940|GLYCOGENSYNTH-PWY|PWY-5941|PWY-5661}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |