Difference between revisions of "GLYCOLYSIS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-K
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
−
** citrate
+
** glycolysis I (from glucose 6-phosphate)
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** citr
+
** Embden-Meyerhof pathway
−
** cit
+
** Embden-Meyerhof-Parnas pathway
−
** citric acid
+
** EMP pathway
−
** 2-hydroxy-1,2,3-propanetricarboxylic acid
+
** glycolysis (plastidic)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
'''12''' reactions found over '''12''' reactions in the full pathway
−
* [[biomass_rxn]]
+
* [[2PGADEHYDRAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 3 associated gene(s):
−
* [[CITSYN-RXN]]
+
*** [[Ec-14_005400]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-27_004000]]
−
* [[RXN-14047]]
+
*** [[Ec-26_004120]]
−
* [[ACONITATEDEHYDR-RXN]]
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3PGAREARR-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-27_000330]]
 +
*** [[Ec-24_002670]]
 +
*** [[Ec-10_005410]]
 +
*** [[Ec-03_002160]]
 +
*** [[Ec-03_002170]]
 +
*** [[Ec-01_000980]]
 +
*** [[Ec-06_009930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-14_003880]]
 +
*** [[Ec-22_000070]]
 +
*** [[Ec-12_002540]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[F16ALDOLASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-10_004980]]
 +
*** [[Ec-01_008040]]
 +
*** [[Ec-10_000880]]
 +
*** [[Ec-14_001680]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[F16BDEPHOS-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-06_004200]]
 +
*** [[Ec-04_004710]]
 +
*** [[Ec-17_003090]]
 +
*** [[Ec-12_004070]]
 +
*** [[Ec-14_005760]]
 +
*** [[Ec-22_000360]]
 +
*** [[Ec-21_001790]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-25_003550]]
 +
*** [[Ec-19_001850]]
 +
*** [[Ec-19_003020]]
 +
*** [[Ec-08_000500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPDEPHOS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_004170]]
 +
*** [[Ec-06_006860]]
 +
*** [[Ec-12_000950]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPSYNTH-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Ec-12_004530]]
 +
*** [[Ec-21_005710]]
 +
*** [[Ec-21_004220]]
 +
*** [[Ec-08_002400]]
 +
*** [[Ec-12_004550]]
 +
*** [[Ec-01_001350]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-15513]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-08_000500]]
 +
*** [[Ec-24_000360]]
 +
*** [[Ec-03_002790]]
 +
*** [[Ec-23_004160]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 77-92-9
+
* ECOCYC:
−
* BIGG : 34080
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=31348 31348]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
−
* KNAPSACK : C00007619
+
{{#set: taxonomic range=TAX-2759}}
−
* HMDB : HMDB00094
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00158 C00158]
+
{{#set: common name=glycolysis I (from glucose 6-phosphate)}}
−
* CHEMSPIDER:
+
{{#set: common name=Embden-Meyerhof pathway|Embden-Meyerhof-Parnas pathway|EMP pathway|glycolysis (plastidic)}}
−
** [http://www.chemspider.com/Chemical-Structure.29081.html 29081]
+
{{#set: reaction found=12}}
−
* CHEBI:
+
{{#set: total reaction=12}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16947 16947]
+
{{#set: completion rate=100.0}}
−
* METABOLIGHTS : MTBLC16947
+
−
{{#set: smiles=C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-K}}
+
−
{{#set: common name=citrate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=citr|cit|citric acid|2-hydroxy-1,2,3-propanetricarboxylic acid}}
+
−
{{#set: consumed by=ATP-CITRATE-PRO-S--LYASE-RXN|biomass_rxn}}
+
−
{{#set: produced by=CITSYN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14047|ACONITATEDEHYDR-RXN}}
+

Latest revision as of 19:30, 21 March 2018

Pathway GLYCOLYSIS

  • taxonomic range:
  • common name:
    • glycolysis I (from glucose 6-phosphate)
  • Synonym(s):
    • Embden-Meyerhof pathway
    • Embden-Meyerhof-Parnas pathway
    • EMP pathway
    • glycolysis (plastidic)

Reaction(s) found

12 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLYCOLYSIS&oldid=27340"