Difference between revisions of "PWY-0"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-0 PWY-0] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-0 PWY-0] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** putrescine degradation III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-37]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-11_002450]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[orthology-aragem]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-0 RXN-0] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1 RXN-1] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-36 RXN-36] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40674}} | |
| − | + | {{#set: common name=putrescine degradation III}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:30, 21 March 2018
Pathway PWY-0
- taxonomic range:
- common name:
- putrescine degradation III
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-37
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
