|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOGLUCMUT-RXN PHOSPHOGLUCMUT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-] |
| + | * inchi key: |
| + | ** InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K |
| * common name: | | * common name: |
− | ** Phosphomannomutase/phosphoglucomutase | + | ** 3-deoxy-D-arabino-heptulosonate 7-phosphate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/5.4.2.2 EC-5.4.2.2] | + | ** 285.124 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 3-deoxy-D-arabino-heptulosonate-7-P |
| + | ** 3-deoxy-arabino-heptulosonate 7-phosphate |
| + | ** 3-deoxy-arabino-heptulosonate-7-P |
| + | ** 2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate |
| + | ** 3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate |
| + | ** 3-deoxy-arabino-heptulonate 7-phosphate |
| + | ** DAHP |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
− | ** 1 [[GLC-1-P]][c] '''<=>''' 1 [[D-glucopyranose-6-phosphate]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 α-D-glucopyranose 1-phosphate[c] '''<=>''' 1 D-glucopyranose 6-phosphate[c]
| + | * [[DAHPSYN-RXN]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-17_001480]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
| + | |
− | ** '''3''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7343]], UDP-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-622]], starch biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-622 PWY-622]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6731]], starch degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[GLUCOSE1PMETAB-PWY]], glucose and glucose-1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6737]], starch degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-2723]], trehalose degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[GLYCOGENSYNTH-PWY]], glycogen biosynthesis I (from ADP-D-Glucose): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENSYNTH-PWY GLYCOGENSYNTH-PWY] | + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5661]], GDP-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5661 PWY-5661]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-5941]], glycogen degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941]
| + | |
− | ** '''1''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5940]], streptomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5940 PWY-5940]
| + | |
− | ** '''2''' reactions found over '''18''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 2627-73-8 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23536 23536]
| + | * PUBCHEM: |
− | * PIR:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460215 5460215] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A41801 A41801]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A53614 A53614]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58394 58394] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B53614 B53614] | + | * BIGG : 44349 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E70650 E70650] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G64803 G64803]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04691 C04691] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G81947 G81947]
| + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)C(O)COP([O-])(=O)[O-]}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I39487 I39487] | + | {{#set: inchi key=InChIKey=PJWIPEXIFFQAQZ-PUFIMZNGSA-K}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I41215 I41215] | + | {{#set: common name=3-deoxy-D-arabino-heptulosonate 7-phosphate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRB PMRB]
| + | {{#set: molecular weight=285.124 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRBI PMRBI]
| + | {{#set: common name=3-deoxy-D-arabino-heptulosonate-7-P|3-deoxy-arabino-heptulosonate 7-phosphate|3-deoxy-arabino-heptulosonate-7-P|2-dehydro-3-deoxy-D-arabino-heptonate 7-phosphate|3-deoxy-D-arabino-hept-2-ulosonate 7-phosphate|3-deoxy-arabino-heptulonate 7-phosphate|DAHP}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PMRT PMRT] | + | {{#set: consumed by=3-DEHYDROQUINATE-SYNTHASE-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S10741 S10741] | + | {{#set: reversible reaction associated=DAHPSYN-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S39397 S39397]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41199 S41199] | + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41200 S41200]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S76847 S76847]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78440 S78440]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04326 T04326]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04327 T04327]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T12574 T12574]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T52656 T52656]
| + | |
− | * LIGAND-RXN:
| + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00959 R00959]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P36871 P36871]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40390 P40390]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40391 P40391]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95090 P95090]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36938 P36938]
| + | |
− | ** [http://www.uniprot.org/uniprot/P57002 P57002]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38569 P38569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31120 P31120]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00949 P00949]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38652 P38652]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2K5 Q7M2K5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16106 Q16106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33401 P33401]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37012 P37012]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74643 P74643]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51847 Q51847]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93804 P93804]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93805 P93805]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93262 P93262]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SCY0 Q9SCY0]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Phosphomannomutase/phosphoglucomutase}} | + | |
− | {{#set: ec number=EC-5.4.2.2}} | + | |
− | {{#set: gene associated=Ec-17_001480}} | + | |
− | {{#set: in pathway=PWY-7238|PWY-5384|GLYCOCAT-PWY|PWY-7343|PWY-3801|PWY-622|PWY-6731|GLUCOSE1PMETAB-PWY|PWY-6737|PWY-6317|PWY-2723|GLYCOGENSYNTH-PWY|PWY-5661|PWY66-422|PWY-5941|PWY-5940}}
| + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |