Difference between revisions of "DISULFOXRED-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DISULFOXRED-RXN DISULFOXRED-RXN] == * direction: ** REVERSIBLE * common name: ** protein disulfide...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DISULFOXRED-RXN DISULFOXRED-RXN] ==
−
* smiles:
+
* direction:
−
** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
+
 
* common name:
 
* common name:
−
** L-selenocystathionine
+
** protein disulfide oxidoreductase
−
* molecular weight:
+
−
** 269.159   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12729]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Protein-Red-Disulfides]][c] '''<=>''' 1 [[Protein-Ox-Disulfides]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-15137]]
+
** 1 a protein with reduced sulfide groups[c] '''<=>''' 1 a protein with oxidized disulfide bonds[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-26_003600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_003380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_000430]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_002590]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-05_004840]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_005080]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580]
+
{{#set: common name=protein disulfide oxidoreductase}}
−
* CHEBI:
+
{{#set: gene associated=Ec-26_003600|Ec-21_003380|Ec-02_000430|Ec-11_002590|Ec-05_004840|Ec-21_005080}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* HMDB : HMDB06343
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}}
+
−
{{#set: common name=L-selenocystathionine}}
+
−
{{#set: molecular weight=269.159    }}
+
−
{{#set: consumed by=RXN-12729}}
+
−
{{#set: consumed or produced by=RXN-15137}}
+

Latest revision as of 19:30, 21 March 2018

Reaction DISULFOXRED-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • protein disulfide oxidoreductase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DISULFOXRED-RXN&oldid=27368"