Difference between revisions of "PWY-7727"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727] ==
* smiles:
+
* taxonomic range:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** 71-hydroxychlorophyllide a
+
** docosahexaenoate biosynthesis IV (4-desaturase, mammals)
* molecular weight:
+
** 628.966   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxychlorophyllide a (misleading)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7677]]
+
'''5''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-13442]]
* [[RXN-7676]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13443]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13444]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13445]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16103]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17119 RXN-17119]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
+
{{#set: taxonomic range=TAX-2759}}
* LIGAND-CPD:
+
{{#set: common name=docosahexaenoate biosynthesis IV (4-desaturase, mammals)}}
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
+
{{#set: reaction found=5}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: total reaction=6}}
{{#set: common name=71-hydroxychlorophyllide a}}
+
{{#set: completion rate=83.0}}
{{#set: molecular weight=628.966    }}
+
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
+
{{#set: consumed by=RXN-7677}}
+
{{#set: produced by=RXN-7676}}
+

Latest revision as of 19:30, 21 March 2018

Pathway PWY-7727

  • taxonomic range:
  • common name:
    • docosahexaenoate biosynthesis IV (4-desaturase, mammals)
  • Synonym(s):

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links