Difference between revisions of "Ec-00 000630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Gene == Gene Ec-00_000630 == * left end position: ** 870519 * transcription direction: ** POSITIVE * right end position: ** 872686 * centisome position: ** 4.5946...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_000630 == |
− | * | + | * left end position: |
− | ** | + | ** 870519 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 872686 |
− | * | + | * centisome position: |
− | ** | + | ** 4.594633 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_1147_0001 | ||
+ | ** Esi1147_0001 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=870519}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=872686}} | |
− | + | {{#set: centisome position=4.594633 }} | |
− | + | {{#set: common name=Esi_1147_0001|Esi1147_0001}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:30, 21 March 2018
Gene Ec-00_000630
- left end position:
- 870519
- transcription direction:
- POSITIVE
- right end position:
- 872686
- centisome position:
- 4.594633
- Synonym(s):
- Esi_1147_0001
- Esi1147_0001
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome