Difference between revisions of "CPD-15364"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** ricinoleoyl-CoA |
+ | * molecular weight: | ||
+ | ** 1043.952 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 12-hydroxy-9-octadecenoyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | * [[RXN-16151]] |
− | * [ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658767 90658767] |
− | {{#set: | + | {{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J}} |
− | {{#set: | + | {{#set: common name=ricinoleoyl-CoA}} |
+ | {{#set: molecular weight=1043.952 }} | ||
+ | {{#set: common name=12-hydroxy-9-octadecenoyl-CoA}} | ||
+ | {{#set: reversible reaction associated=RXN-16151}} |
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite CPD-15364
- smiles:
- CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J
- common name:
- ricinoleoyl-CoA
- molecular weight:
- 1043.952
- Synonym(s):
- 12-hydroxy-9-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.