Difference between revisions of "CPD-19158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_000340 == * left end position: ** 243475 * transcription direction: ** POSITIVE * right end position: ** 262944 * centisome position: ** 2.3595...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-01_000340 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
* left end position:
+
* smiles:
** 243475
+
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
* right end position:
+
* common name:
** 262944
+
** 3-oxo-(9Z)-hexadecenoyl-CoA
* centisome position:
+
* molecular weight:
** 2.3595204    
+
** 1013.883    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0207_0057
+
** 3-oxo-16:1-Δ9-CoA
** Esi0207_0057
+
** 3-oxo-9-cis-hexadecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PMPOXI-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-17790]]
***go-term
+
== Reaction(s) of unknown directionality ==
* [[PNPOXI-RXN]]
+
** esiliculosus_genome
+
***go-term
+
== Pathways associated ==
+
* [[PWY-7204]]
+
* [[PWY-7282]]
+
* [[PLPSAL-PWY]]
+
* [[PYRIDOXSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=243475}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
{{#set: right end position=262944}}
+
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
{{#set: centisome position=2.3595204   }}
+
{{#set: molecular weight=1013.883   }}
{{#set: common name=Esi_0207_0057|Esi0207_0057}}
+
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
{{#set: reaction associated=PMPOXI-RXN|PNPOXI-RXN}}
+
{{#set: produced by=RXN-17790}}
{{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}}
+

Latest revision as of 19:30, 21 March 2018

Metabolite CPD-19158

  • smiles:
    • CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
  • common name:
    • 3-oxo-(9Z)-hexadecenoyl-CoA
  • molecular weight:
    • 1013.883
  • Synonym(s):
    • 3-oxo-16:1-Δ9-CoA
    • 3-oxo-9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.