Difference between revisions of "RXN-11501"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] == * direction: ** LEFT-TO-RIGHT * common name: ** Alpha-galactosidase, family...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 71-hydroxychlorophyllide a
+
** Alpha-galactosidase, family GH36
−
* molecular weight:
+
* ec number:
−
** 628.966   
+
** [http://enzyme.expasy.org/EC/3.2.1.22 EC-3.2.1.22]
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxychlorophyllide a (misleading)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7677]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-170]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-1099]][c] '''+''' 1 [[ALPHA-D-GALACTOSE]][c]
−
* [[RXN-7676]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 stachyose[c] '''+''' 1 H2O[c] '''=>''' 1 raffinose[c] '''+''' 1 α-D-galactose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-17_000840]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_006290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03634 R03634]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
+
{{#set: common name=Alpha-galactosidase, family GH36}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: ec number=EC-3.2.1.22}}
−
{{#set: common name=71-hydroxychlorophyllide a}}
+
{{#set: gene associated=Ec-17_000840|Ec-26_006290}}
−
{{#set: molecular weight=628.966    }}
+
{{#set: in pathway=PWY-6527}}
−
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: consumed by=RXN-7677}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN-7676}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:30, 21 March 2018

Reaction RXN-11501

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Alpha-galactosidase, family GH36
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6527, stachyose degradation: PWY-6527
    • 5 reactions found over 7 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11501&oldid=27425"