Difference between revisions of "Ec-00 007000"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * smiles: ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=...")
(Created page with "Category:Gene == Gene Ec-00_007000 == * left end position: ** 11050398 * transcription direction: ** POSITIVE * right end position: ** 11054197 * centisome position: ** 58...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] ==
+
== Gene Ec-00_007000 ==
* smiles:
+
* left end position:
** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
+
** 11050398
* inchi key:
+
* transcription direction:
** InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K
+
** POSITIVE
* common name:
+
* right end position:
** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine
+
** 11054197
* molecular weight:
+
* centisome position:
** 1075.843    
+
** 58.324425    
 
* Synonym(s):
 
* Synonym(s):
** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)
+
** Esi_0529_0004
** UDP-MurNAc-tetrapeptide
+
** Esi0529_0004
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11347]]
+
* Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=11050398}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658175 90658175]
+
{{#set: transcription direction=POSITIVE}}
* LIGAND-CPD:
+
{{#set: right end position=11054197}}
** [http://www.genome.jp/dbget-bin/www_bget?C06432 C06432]
+
{{#set: centisome position=58.324425   }}
{{#set: smiles=CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}}
+
{{#set: common name=Esi_0529_0004|Esi0529_0004}}
{{#set: inchi key=InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K}}
+
{{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN}}
{{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine}}
+
{{#set: molecular weight=1075.843   }}
+
{{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)|UDP-MurNAc-tetrapeptide}}
+
{{#set: consumed by=RXN-11347}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-00_007000

  • left end position:
    • 11050398
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11054197
  • centisome position:
    • 58.324425
  • Synonym(s):
    • Esi_0529_0004
    • Esi0529_0004

Reactions associated

Pathways associated

External links