Difference between revisions of "Ec-05 002630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
(Created page with "Category:Gene == Gene Ec-05_002630 == * left end position: ** 4298444 * transcription direction: ** NEGATIVE * right end position: ** 4317131 * centisome position: ** 47.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_002630 == |
− | * | + | * left end position: |
− | ** | + | ** 4298444 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4317131 |
− | * | + | * centisome position: |
− | ** | + | ** 47.21747 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0004_0170 |
− | ** | + | ** Esi0004_0170 |
− | ** | + | ** CSTF64 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4298444}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4317131}} | |
− | + | {{#set: centisome position=47.21747 }} | |
− | + | {{#set: common name=Esi_0004_0170|Esi0004_0170|CSTF64}} | |
− | {{#set: | + | {{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-05_002630
- left end position:
- 4298444
- transcription direction:
- NEGATIVE
- right end position:
- 4317131
- centisome position:
- 47.21747
- Synonym(s):
- Esi_0004_0170
- Esi0004_0170
- CSTF64
Reactions associated
- Reaction: 4-NITROPHENYLPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome