Difference between revisions of "Ec-19 002750"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == * smiles: ** CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Gene == Gene Ec-19_002750 == * left end position: ** 3042016 * transcription direction: ** NEGATIVE * right end position: ** 3047279 * centisome position: ** 50.9...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] ==
+
== Gene Ec-19_002750 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3042016
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** hexanoyl-CoA
+
** 3047279
−
* molecular weight:
+
* centisome position:
−
** 861.647    
+
** 50.94917    
 
* Synonym(s):
 
* Synonym(s):
−
** hexanoyl-coenzyme A
+
** Esi_0035_0121
 +
** Esi0035_0121
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NARINGENIN-3-DIOXYGENASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
−
* [[RXN-14277]]
+
* Reaction: [[RXN-113]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-115]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-171]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-527]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-602]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-6550]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-7648]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-7775]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-7922]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8450]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-162]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-163]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-165]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-167]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-168]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-93]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-5059]]
 +
* [[PWY1F-FLAVSYN]]
 +
* [[PWY-6787]]
 +
* [[PWY-5035]]
 +
* [[PWY-5390]]
 +
* [[PWY-5391]]
 +
* [[PWY-5070]]
 +
* [[PWY-5152]]
 +
* [[PWY-3101]]
 +
* [[PWY1F-823]]
 +
* [[PWY-102]]
 
== External links  ==
 
== External links  ==
−
* CAS : 5060-32-2
+
{{#set: left end position=3042016}}
−
* BIGG : 45470
+
{{#set: transcription direction=NEGATIVE}}
−
* DRUGBANK : DB02563
+
{{#set: right end position=3047279}}
−
* PUBCHEM:
+
{{#set: centisome position=50.94917   }}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262356 53262356]
+
{{#set: common name=Esi_0035_0121|Esi0035_0121}}
−
* HMDB : HMDB02845
+
{{#set: reaction associated=NARINGENIN-3-DIOXYGENASE-RXN|RXN-113|RXN-115|RXN-171|RXN-527|RXN-602|RXN-6550|RXN-7648|RXN-7775|RXN-7922|RXN-8450|RXN1F-162|RXN1F-163|RXN1F-165|RXN1F-167|RXN1F-168|RXN1F-93}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5059|PWY1F-FLAVSYN|PWY-6787|PWY-5035|PWY-5390|PWY-5391|PWY-5070|PWY-5152|PWY-3101|PWY1F-823|PWY-102}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05270 C05270]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62620 62620]
+
−
* METABOLIGHTS : MTBLC27540
+
−
{{#set: smiles=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J}}
+
−
{{#set: common name=hexanoyl-CoA}}
+
−
{{#set: molecular weight=861.647   }}
+
−
{{#set: common name=hexanoyl-coenzyme A}}
+
−
{{#set: reversible reaction associated=RXN-14277}}
+

Latest revision as of 19:31, 21 March 2018

Gene Ec-19_002750

  • left end position:
    • 3042016
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3047279
  • centisome position:
    • 50.94917
  • Synonym(s):
    • Esi_0035_0121
    • Esi0035_0121

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_002750&oldid=27497"