Difference between revisions of "PWY-6154"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6154 PWY-6154] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-135623 TAX-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6154 PWY-6154] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-135623 TAX-135623]
* inchi key:
+
** InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I
+
 
* common name:
 
* common name:
** benzoylsuccinyl-CoA
+
** autoinducer AI-2 biosynthesis II (Vibrio)
* molecular weight:
+
** 966.676   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[RXN-905]]
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-22_002610]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10016 RXN-10016]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10018 RXN-10018]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10019 RXN-10019]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7605 RXN-7605]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-135623}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659089 90659089]
+
{{#set: common name=autoinducer AI-2 biosynthesis II (Vibrio)}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28882 28882]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C09820 C09820]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I}}
+
{{#set: common name=benzoylsuccinyl-CoA}}
+
{{#set: molecular weight=966.676    }}
+
{{#set: produced by=RXN-905}}
+

Latest revision as of 20:31, 21 March 2018

Pathway PWY-6154

  • taxonomic range:
  • common name:
    • autoinducer AI-2 biosynthesis II (Vibrio)
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links