|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.6-RXN 3.6.3.6-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: |
| + | ** InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J |
| * common name: | | * common name: |
− | ** Vacuolar (H+)-ATPase G subunit | + | ** hexanoyl-CoA |
− | ** hydrogen-exporting ATPase activity, phosphorylative mechanism | + | * molecular weight: |
− | * ec number:
| + | ** 861.647 |
− | ** [http://enzyme.expasy.org/EC/3.6.3.6 EC-3.6.3.6] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** hexanoyl-coenzyme A |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[ATP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 2 [[PROTON]][e]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-14277]] |
− | ** 1 ATP[c] '''+''' 1 H2O[c] '''+''' 1 H+[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 2 H+[e]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-06_010400]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-07_006840]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]] | + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 5060-32-2 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20852 20852] | + | * BIGG : 45470 |
− | * UNIPROT: | + | * DRUGBANK : DB02563 |
− | ** [http://www.uniprot.org/uniprot/Q9M460 Q9M460] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P21282 P21282] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262356 53262356] |
− | ** [http://www.uniprot.org/uniprot/P11593 P11593]
| + | * HMDB : HMDB02845 |
− | ** [http://www.uniprot.org/uniprot/P11019 P11019]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P11574 P11574] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05270 C05270] |
− | ** [http://www.uniprot.org/uniprot/P23968 P23968] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P27449 P27449] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62620 62620] |
− | ** [http://www.uniprot.org/uniprot/P23957 P23957] | + | * METABOLIGHTS : MTBLC27540 |
− | ** [http://www.uniprot.org/uniprot/P32842 P32842] | + | {{#set: smiles=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.uniprot.org/uniprot/Q08435 Q08435]
| + | {{#set: inchi key=InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P32563 P32563]
| + | {{#set: common name=hexanoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/Q42932 Q42932] | + | {{#set: molecular weight=861.647 }} |
− | ** [http://www.uniprot.org/uniprot/P22180 P22180]
| + | {{#set: common name=hexanoyl-coenzyme A}} |
− | ** [http://www.uniprot.org/uniprot/P38078 P38078]
| + | {{#set: reversible reaction associated=RXN-14277}} |
− | ** [http://www.uniprot.org/uniprot/P38607 P38607]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41807 P41807]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31478 P31478]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M196 Q7M196]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40975 P40975]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39111 P39111]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55277 P55277]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58623 Q58623]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16140 P16140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21281 P21281]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SPD5 Q9SPD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M195 Q7M195]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M290 Q7M290]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q24583 Q24583]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63082 P63082]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31403 P31403]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21283 P21283]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63081 P63081]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23956 P23956]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05030 P05030]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19657 P19657]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25515 P25515]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17255 P17255]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28877 P28877]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24545 P24545]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20649 P20649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19456 P19456]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20431 P20431]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07038 P07038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11592 P11592]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09469 P09469]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09627 P09627]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28876 P28876]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03105 Q03105]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22550 P22550]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31410 P31410]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31404 P31404]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31400 P31400]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04236 Q04236]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04238 Q04238]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04239 Q04239]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04237 Q04237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31401 P31401]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31409 P31409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31406 P31406]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32610 P32610]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32903 P32903]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26250 Q26250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31408 P31408]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50515 P50515]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03194 Q03194]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54211 P54211]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26975 Q26975]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26976 Q26976]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31412 P31412]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34546 P34546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23380 P23380]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31413 P31413]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43182 Q43182]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43178 Q43178]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43106 Q43106]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43271 Q43271]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37296 P37296]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32366 P32366]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39291 Q39291]
| + | |
− | ** [http://www.uniprot.org/uniprot/P59227 P59227]
| + | |
− | ** [http://www.uniprot.org/uniprot/P59229 P59229]
| + | |
− | ** [http://www.uniprot.org/uniprot/P59228 P59228]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22203 P22203]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49087 P49087]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41773 Q41773]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48836 P48836]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37367 P37367]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZQX4 Q9ZQX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39258 Q39258]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43243 Q43243]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40002 Q40002]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82629 O82629]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48614 O48614]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93597 P93597]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SU58 Q9SU58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SZY7 Q9SZY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41396 Q41396]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23948 O23948]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43131 Q43131]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41648 Q41648]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93265 P93265]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40272 Q40272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48414 P48414]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04956 O04956]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48413 P48413]
| + | |
− | ** [http://www.uniprot.org/uniprot/O61112 O61112]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94072 O94072]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17660 Q17660]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q21898 Q21898]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q22087 Q22087]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XXU9 Q9XXU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53659 P53659]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82628 O82628]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SDS7 Q9SDS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9M4N3 Q9M4N3]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Vacuolar (H+)-ATPase G subunit}}
| + | |
− | {{#set: common name=hydrogen-exporting ATPase activity, phosphorylative mechanism}}
| + | |
− | {{#set: ec number=EC-3.6.3.6}}
| + | |
− | {{#set: gene associated=Ec-06_010400|Ec-07_006840}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |