Difference between revisions of "Ec-01 004380"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Gene == Gene Ec-01_004380 == * left end position: ** 3771201 * transcription direction: ** POSITIVE * right end position: ** 3795011 * centisome position: ** 36.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_004380 == |
− | * | + | * left end position: |
− | ** | + | ** 3771201 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3795011 |
− | * | + | * centisome position: |
− | ** | + | ** 36.546776 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0532_0004 |
− | ** | + | ** Esi0532_0004 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=3771201}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3795011}} | |
− | + | {{#set: centisome position=36.546776 }} | |
− | + | {{#set: common name=Esi_0532_0004|Esi0532_0004}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-01_004380
- left end position:
- 3771201
- transcription direction:
- POSITIVE
- right end position:
- 3795011
- centisome position:
- 36.546776
- Synonym(s):
- Esi_0532_0004
- Esi0532_0004
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome