Difference between revisions of "PWY-6531"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-28...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-2870] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5794 TAX-5794] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** mannitol cycle |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''4''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[FRUCTOKINASE-RXN]] | |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-18_002990]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[MANNITOL-1-PHOSPHATASE-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | * [[MANNPDEHYDROG-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Ec-23_000570]] | ||
| + | *** [[Ec-18_001290]] | ||
| + | *** [[Ec-04_003690]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-14515]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-2-DEHYDROGENASE-RXN MANNITOL-2-DEHYDROGENASE-RXN] | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * LIGAND-MAP: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00051 map00051] |
| − | + | {{#set: taxonomic range=TAX-2870}} | |
| − | + | {{#set: taxonomic range=TAX-5794}} | |
| − | + | {{#set: common name=mannitol cycle}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=5}} | |
| − | {{#set: | + | {{#set: completion rate=80.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:31, 21 March 2018
Pathway PWY-6531
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- FRUCTOKINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- MANNITOL-1-PHOSPHATASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- MANNPDEHYDROG-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14515
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP:
