Difference between revisions of "CPD-787"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-05_000630 == * left end position: ** 1426998 * transcription direction: ** POSITIVE * right end position: ** 1440821 * centisome position: ** 15.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L |
− | * | + | * common name: |
− | ** | + | ** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate |
− | * | + | * molecular weight: |
− | ** | + | ** 170.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate |
− | ** | + | ** HHDD |
− | ** | + | ** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN1K-87]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54715389 54715389] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600] |
− | {{#set: common name= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78626 78626] | |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600] | ||
+ | {{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}} | ||
+ | {{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}} | ||
+ | {{#set: molecular weight=170.121 }} | ||
+ | {{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}} | ||
+ | {{#set: reversible reaction associated=RXN1K-87}} |
Latest revision as of 20:31, 21 March 2018
Contents
Metabolite CPD-787
- smiles:
- C([O-])(=O)CC=CC=C(O)C(=O)[O-]
- inchi key:
- InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
- common name:
- (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
- molecular weight:
- 170.121
- Synonym(s):
- (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
- HHDD
- (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CC=CC=C(O)C(=O)[O-" cannot be used as a page name in this wiki.