Difference between revisions of "CPD-5662"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12383 RXN-12383] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M |
| + | * common name: | ||
| + | ** 9-mercaptodethiobiotin | ||
| + | * molecular weight: | ||
| + | ** 245.316 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 9-mercaptodesthiobiotin | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-17473]] | |
| − | + | * [[RXN-17472]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092] |
| − | {{#set: | + | {{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=9-mercaptodethiobiotin}} |
| − | {{#set: | + | {{#set: molecular weight=245.316 }} |
| + | {{#set: common name=9-mercaptodesthiobiotin}} | ||
| + | {{#set: reversible reaction associated=RXN-17473|RXN-17472}} | ||
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite CPD-5662
- smiles:
- C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
- inchi key:
- InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
- common name:
- 9-mercaptodethiobiotin
- molecular weight:
- 245.316
- Synonym(s):
- 9-mercaptodesthiobiotin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.
