Difference between revisions of "Lipid-dihydrosterculate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * inchi key: ** InChIKey=SIKJAQJRHWYJAI-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] == * common name: ** a [glycerolipid]-dihydros...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] ==
* smiles:
+
** C2(C=CC1(=C(C=CN1)C=2))
+
* inchi key:
+
** InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** indole
+
** a [glycerolipid]-dihydrosterculate
* molecular weight:
+
** 117.15   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [glycerolipid]-dihydrosterculic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2382]]
 
* [[INDOLE-23-DIOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7421]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN0-2381]]
 
 
== External links  ==
 
== External links  ==
* CAS : 120-72-9
+
{{#set: common name=a [glycerolipid]-dihydrosterculate}}
* DRUGBANK : DB04532
+
{{#set: common name=a [glycerolipid]-dihydrosterculic acid}}
* PUBCHEM:
+
{{#set: produced by=RXN-7421}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=798 798]
+
* HMDB : HMDB00738
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00463 C00463]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.776.html 776]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16881 16881]
+
* BIGG : 35045
+
{{#set: smiles=C2(C=CC1(=C(C=CN1)C=2))}}
+
{{#set: inchi key=InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N}}
+
{{#set: common name=indole}}
+
{{#set: molecular weight=117.15    }}
+
{{#set: consumed by=RXN0-2382|INDOLE-23-DIOXYGENASE-RXN}}
+
{{#set: reversible reaction associated=RXN0-2381}}
+

Latest revision as of 19:32, 21 March 2018

Metabolite Lipid-dihydrosterculate

  • common name:
    • a [glycerolipid]-dihydrosterculate
  • Synonym(s):
    • a [glycerolipid]-dihydrosterculic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-dihydrosterculate" cannot be used as a page name in this wiki.
"a [glycerolipid]-dihydrosterculic acid" cannot be used as a page name in this wiki.