Difference between revisions of "Ec-18 001420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-18_001420 == * left end position: ** 1352912 * transcription direction: ** POSITIVE * right end position: ** 1355875 * centisome position: ** 27.4...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_001420 == |
− | * | + | * left end position: |
− | ** | + | ** 1352912 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1355875 |
− | * | + | * centisome position: |
− | ** | + | ** 27.461613 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0269_0016 |
− | ** | + | ** Esi0269_0016 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5021]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1352912}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1355875}} | |
− | + | {{#set: centisome position=27.461613 }} | |
− | + | {{#set: common name=Esi_0269_0016|Esi0269_0016}} | |
− | + | {{#set: reaction associated=RXN0-5021}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Gene Ec-18_001420
- left end position:
- 1352912
- transcription direction:
- POSITIVE
- right end position:
- 1355875
- centisome position:
- 27.461613
- Synonym(s):
- Esi_0269_0016
- Esi0269_0016
Reactions associated
- Reaction: RXN0-5021
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome