Difference between revisions of "TransportSeed COB-I-ALAMIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_COB-I-ALAMIN TransportSeed_COB-I-ALAMIN] == * direction: ** LEFT-TO-RIGHT * Synonym(s...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_COB-I-ALAMIN TransportSeed_COB-I-ALAMIN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1.0 [[COB-I-ALAMIN]][e] '''=>''' 1.0 [[COB-I-ALAMIN]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 cob(I)alamin[e] '''=>''' 1.0 cob(I)alamin[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-import_from_medium]] | ||
+ | *** Comment: [[added to manage seeds from extracellular to cytosol compartment]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-import_from_medium}} | |
− | + | {{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Contents
Reaction TransportSeed_COB-I-ALAMIN
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 COB-I-ALAMIN[e] => 1.0 COB-I-ALAMIN[c]
- With common name(s):
- 1.0 cob(I)alamin[e] => 1.0 cob(I)alamin[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual