Difference between revisions of "INDOLE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * inchi key: ** InChIKey=SIKJAQJRHWYJAI-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C2(C=CC1(=C(C=CN1)C=2))
 +
* inchi key:
 +
** InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
 
* common name:
 
* common name:
** arachidonate biosynthesis V (8-detaturase, mammals)
+
** indole
 +
* molecular weight:
 +
** 117.15   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''5''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN0-2382]]
* [[RXN-16094]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
** 0 associated gene:
+
== Reaction(s) known to produce the compound ==
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
* [[RXN0-2381]]
* [[RXN-16095]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
* [[RXN-16096]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
* [[RXN-16097]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
* [[RXN-17105]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16064 RXN-16064]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 120-72-9
{{#set: common name=arachidonate biosynthesis V (8-detaturase, mammals)}}
+
* DRUGBANK : DB04532
{{#set: reaction found=5}}
+
* PUBCHEM:
{{#set: total reaction=6}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=798 798]
{{#set: completion rate=83.0}}
+
* HMDB : HMDB00738
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00463 C00463]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.776.html 776]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16881 16881]
 +
* BIGG : 35045
 +
{{#set: smiles=C2(C=CC1(=C(C=CN1)C=2))}}
 +
{{#set: inchi key=InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N}}
 +
{{#set: common name=indole}}
 +
{{#set: molecular weight=117.15    }}
 +
{{#set: consumed by=RXN0-2382|INDOLE-23-DIOXYGENASE-RXN}}
 +
{{#set: reversible reaction associated=RXN0-2381}}

Latest revision as of 19:32, 21 March 2018

Metabolite INDOLE

  • smiles:
    • C2(C=CC1(=C(C=CN1)C=2))
  • inchi key:
    • InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
  • common name:
    • indole
  • molecular weight:
    • 117.15
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 120-72-9
  • DRUGBANK : DB04532
  • PUBCHEM:
  • HMDB : HMDB00738
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • BIGG : 35045