Difference between revisions of "PWY-7118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** chitin degradation to ethanol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[1.1.1.39-RXN]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Ec-01_003680]] | ||
| + | *** [[Ec-07_002070]] | ||
| + | *** [[Ec-07_002060]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[ACETATE--COA-LIGASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-21_006210]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[MALSYN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-12_003860]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=CHITIN-DEACETYLASE-RXN CHITIN-DEACETYLASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6161 RXN-6161] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33154}} | |
| − | + | {{#set: common name=chitin degradation to ethanol}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:32, 21 March 2018
Pathway PWY-7118
- taxonomic range:
- common name:
- chitin degradation to ethanol
- Synonym(s):
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- 1.1.1.39-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETATE--COA-LIGASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- MALSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
