Difference between revisions of "PWY-7118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] ==
* smiles:
+
* taxonomic range:
** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
* inchi key:
+
** InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** amino-parathion
+
** chitin degradation to ethanol
* molecular weight:
+
** 261.275   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+
'''3''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-01_003680]]
 +
*** [[Ec-07_002070]]
 +
*** [[Ec-07_002060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_006210]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MALSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_003860]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=CHITIN-DEACETYLASE-RXN CHITIN-DEACETYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6161 RXN-6161]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33154}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=220 220]
+
{{#set: common name=chitin degradation to ethanol}}
* LIGAND-CPD:
+
{{#set: reaction found=3}}
** [http://www.genome.jp/dbget-bin/www_bget?C06605 C06605]
+
{{#set: total reaction=6}}
* HMDB : HMDB01504
+
{{#set: completion rate=50.0}}
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)N))(OCC)=S}}
+
{{#set: inchi key=InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N}}
+
{{#set: common name=amino-parathion}}
+
{{#set: molecular weight=261.275    }}
+
{{#set: consumed by=AMINOPARATHION-PHOSPHATASE-RXN}}
+

Latest revision as of 19:32, 21 March 2018

Pathway PWY-7118

  • taxonomic range:
  • common name:
    • chitin degradation to ethanol
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links